C15H16ClN5O2S — CID 43051815
5-chloro-N'-[3-(dimethylamino)benzoyl]-2-methylsulfanylpyrimidine-4-carbohydrazide (PubChem CID 43051815) has the molecular formula C15H16ClN5O2S and a molecular weight of 365.85 g/mol. Its IUPAC name is 5-chloro-N'-[3-(dimethylamino)benzoyl]-2-methylsulfanylpyrimidine-4-carbohydrazide.
| Compound Name | 5-chloro-N'-[3-(dimethylamino)benzoyl]-2-methylsulfanylpyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 43051815 |
| Molecular Formula | C15H16ClN5O2S |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 5-chloro-N'-[3-(dimethylamino)benzoyl]-2-methylsulfanylpyrimidine-4-carbohydrazide |
| SMILES | CSc1ncc(Cl)c(C(=O)NNC(=O)c2cccc(N(C)C)c2)n1 |
| InChI | InChI=1S/C15H16ClN5O2S/c1-21(2)10-6-4-5-9(7-10)13(22)19-20-14(23)12-11(16)8-17-15(18-12)24-3/h4-8H,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | DOVHCWMUWCXFFN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|