C10H14ClN5OS2 — CID 24672599
1-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-propan-2-ylthiourea (PubChem CID 24672599) has the molecular formula C10H14ClN5OS2 and a molecular weight of 319.84 g/mol. Its IUPAC name is 1-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-propan-2-ylthiourea.
| Compound Name | 1-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 24672599 |
| Molecular Formula | C10H14ClN5OS2 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 1-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-propan-2-ylthiourea |
| SMILES | CSc1ncc(Cl)c(C(=O)NNC(=S)NC(C)C)n1 |
| InChI | InChI=1S/C10H14ClN5OS2/c1-5(2)13-9(18)16-15-8(17)7-6(11)4-12-10(14-7)19-3/h4-5H,1-3H3,(H,15,17)(H2,13,16,18) |
| InChIKey | NWASXACOILJVFJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|