C15H15ClN4O2S — CID 43036852
5-chloro-N'-(2,4-dimethylbenzoyl)-2-methylsulfanylpyrimidine-4-carbohydrazide (PubChem CID 43036852) has the molecular formula C15H15ClN4O2S and a molecular weight of 350.83 g/mol. Its IUPAC name is 5-chloro-N'-(2,4-dimethylbenzoyl)-2-methylsulfanylpyrimidine-4-carbohydrazide.
| Compound Name | 5-chloro-N'-(2,4-dimethylbenzoyl)-2-methylsulfanylpyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 43036852 |
| Molecular Formula | C15H15ClN4O2S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 5-chloro-N'-(2,4-dimethylbenzoyl)-2-methylsulfanylpyrimidine-4-carbohydrazide |
| SMILES | CSc1ncc(Cl)c(C(=O)NNC(=O)c2ccc(C)cc2C)n1 |
| InChI | InChI=1S/C15H15ClN4O2S/c1-8-4-5-10(9(2)6-8)13(21)19-20-14(22)12-11(16)7-17-15(18-12)23-3/h4-7H,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | ZIRCLNIULGNTRU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|