C12H13ClN6OS — CID 36809648
5-chloro-N'-(4,6-dimethylpyrimidin-2-yl)-2-methylsulfanylpyrimidine-4-carbohydrazide (PubChem CID 36809648) has the molecular formula C12H13ClN6OS and a molecular weight of 324.80 g/mol. Its IUPAC name is 5-chloro-N'-(4,6-dimethylpyrimidin-2-yl)-2-methylsulfanylpyrimidine-4-carbohydrazide.
| Compound Name | 5-chloro-N'-(4,6-dimethylpyrimidin-2-yl)-2-methylsulfanylpyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 36809648 |
| Molecular Formula | C12H13ClN6OS |
| Molecular Weight | 324.80 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 5-chloro-N'-(4,6-dimethylpyrimidin-2-yl)-2-methylsulfanylpyrimidine-4-carbohydrazide |
| SMILES | CSc1ncc(Cl)c(C(=O)NNc2nc(C)cc(C)n2)n1 |
| InChI | InChI=1S/C12H13ClN6OS/c1-6-4-7(2)16-11(15-6)19-18-10(20)9-8(13)5-14-12(17-9)21-3/h4-5H,1-3H3,(H,18,20)(H,15,16,19) |
| InChIKey | RTGMCQBXTSIDIS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|