C9H12ClN3O2S — CID 43418256
5-chloro-N-(2-hydroxypropyl)-2-methylsulfanylpyrimidine-4-carboxamide (PubChem CID 43418256) has the molecular formula C9H12ClN3O2S and a molecular weight of 261.73 g/mol. Its IUPAC name is 5-chloro-N-(2-hydroxypropyl)-2-methylsulfanylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(2-hydroxypropyl)-2-methylsulfanylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 43418256 |
| Molecular Formula | C9H12ClN3O2S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 5-chloro-N-(2-hydroxypropyl)-2-methylsulfanylpyrimidine-4-carboxamide |
| SMILES | CSc1ncc(Cl)c(C(=O)NCC(C)O)n1 |
| InChI | InChI=1S/C9H12ClN3O2S/c1-5(14)3-11-8(15)7-6(10)4-12-9(13-7)16-2/h4-5,14H,3H2,1-2H3,(H,11,15) |
| InChIKey | WRWZDSRKDAZTLK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |