C11H14ClN3O3S — CID 65217834
2-[[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]methyl]butanoic acid (PubChem CID 65217834) has the molecular formula C11H14ClN3O3S and a molecular weight of 303.77 g/mol. Its IUPAC name is 2-[[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]methyl]butanoic acid.
| Compound Name | 2-[[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65217834 |
| Molecular Formula | C11H14ClN3O3S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-[[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]methyl]butanoic acid |
| SMILES | CCC(CNC(=O)c1nc(SC)ncc1Cl)C(=O)O |
| InChI | InChI=1S/C11H14ClN3O3S/c1-3-6(10(17)18)4-13-9(16)8-7(12)5-14-11(15-8)19-2/h5-6H,3-4H2,1-2H3,(H,13,16)(H,17,18) |
| InChIKey | PFKMIZDLPAFIMM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |