C12H16ClN3O3S — CID 65218897
2-[[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]methyl]pentanoic acid (PubChem CID 65218897) has the molecular formula C12H16ClN3O3S and a molecular weight of 317.80 g/mol. Its IUPAC name is 2-[[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]methyl]pentanoic acid.
| Compound Name | 2-[[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 65218897 |
| Molecular Formula | C12H16ClN3O3S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-[[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]methyl]pentanoic acid |
| SMILES | CCCC(CNC(=O)c1nc(SC)ncc1Cl)C(=O)O |
| InChI | InChI=1S/C12H16ClN3O3S/c1-3-4-7(11(18)19)5-14-10(17)9-8(13)6-15-12(16-9)20-2/h6-7H,3-5H2,1-2H3,(H,14,17)(H,18,19) |
| InChIKey | PWMAETUPHXABRX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |