C10H12ClN3O4S — CID 81076878
2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-methoxypropanoic acid (PubChem CID 81076878) has the molecular formula C10H12ClN3O4S and a molecular weight of 305.74 g/mol. Its IUPAC name is 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-methoxypropanoic acid.
| Compound Name | 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81076878 |
| Molecular Formula | C10H12ClN3O4S |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)c1nc(SC)ncc1Cl)C(=O)O |
| InChI | InChI=1S/C10H12ClN3O4S/c1-18-4-6(9(16)17)13-8(15)7-5(11)3-12-10(14-7)19-2/h3,6H,4H2,1-2H3,(H,13,15)(H,16,17) |
| InChIKey | WNJGBKUAYNRVGH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |