C18H20ClN3O3S — CID 46552530
propan-2-yl 3-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-phenylpropanoate (PubChem CID 46552530) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is propan-2-yl 3-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl 3-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 46552530 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | propan-2-yl 3-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-phenylpropanoate |
| SMILES | CSc1ncc(Cl)c(C(=O)NC(CC(=O)OC(C)C)c2ccccc2)n1 |
| InChI | InChI=1S/C18H20ClN3O3S/c1-11(2)25-15(23)9-14(12-7-5-4-6-8-12)21-17(24)16-13(19)10-20-18(22-16)26-3/h4-8,10-11,14H,9H2,1-3H3,(H,21,24) |
| InChIKey | XIDWPSHSJGUFPN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |