C21H20ClN3OS — CID 24653889
5-chloro-N-(2,2-diphenylpropyl)-2-methylsulfanylpyrimidine-4-carboxamide (PubChem CID 24653889) has the molecular formula C21H20ClN3OS and a molecular weight of 397.93 g/mol. Its IUPAC name is 5-chloro-N-(2,2-diphenylpropyl)-2-methylsulfanylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(2,2-diphenylpropyl)-2-methylsulfanylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 24653889 |
| Molecular Formula | C21H20ClN3OS |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 5-chloro-N-(2,2-diphenylpropyl)-2-methylsulfanylpyrimidine-4-carboxamide |
| SMILES | CSc1ncc(Cl)c(C(=O)NCC(C)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C21H20ClN3OS/c1-21(15-9-5-3-6-10-15,16-11-7-4-8-12-16)14-24-19(26)18-17(22)13-23-20(25-18)27-2/h3-13H,14H2,1-2H3,(H,24,26) |
| InChIKey | JLUCMSDIMMWTHY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |