C12H16ClN3O3S — CID 43423370
methyl 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-methylbutanoate (PubChem CID 43423370) has the molecular formula C12H16ClN3O3S and a molecular weight of 317.80 g/mol. Its IUPAC name is methyl 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 43423370 |
| Molecular Formula | C12H16ClN3O3S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | methyl 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)c1nc(SC)ncc1Cl)C(C)C |
| InChI | InChI=1S/C12H16ClN3O3S/c1-6(2)8(11(18)19-3)15-10(17)9-7(13)5-14-12(16-9)20-4/h5-6,8H,1-4H3,(H,15,17) |
| InChIKey | TWVUUYFJSAERHR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |