C21H25NO3S — CID 55532937
propan-2-yl 3-[(2-methyl-5-methylsulfanylbenzoyl)amino]-3-phenylpropanoate (PubChem CID 55532937) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is propan-2-yl 3-[(2-methyl-5-methylsulfanylbenzoyl)amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl 3-[(2-methyl-5-methylsulfanylbenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 55532937 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | propan-2-yl 3-[(2-methyl-5-methylsulfanylbenzoyl)amino]-3-phenylpropanoate |
| SMILES | CSc1ccc(C)c(C(=O)NC(CC(=O)OC(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C21H25NO3S/c1-14(2)25-20(23)13-19(16-8-6-5-7-9-16)22-21(24)18-12-17(26-4)11-10-15(18)3/h5-12,14,19H,13H2,1-4H3,(H,22,24) |
| InChIKey | NUWVASZAXAHROE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |