C19H23ClN2O3S — CID 120630951
methyl 3-[(5-amino-2-methylbenzoyl)amino]-3-(4-methylsulfanylphenyl)propanoate;hydrochloride (PubChem CID 120630951) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is methyl 3-[(5-amino-2-methylbenzoyl)amino]-3-(4-methylsulfanylphenyl)propanoate;hydrochloride.
| Compound Name | methyl 3-[(5-amino-2-methylbenzoyl)amino]-3-(4-methylsulfanylphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 120630951 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | methyl 3-[(5-amino-2-methylbenzoyl)amino]-3-(4-methylsulfanylphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)CC(NC(=O)c1cc(N)ccc1C)c1ccc(SC)cc1.Cl |
| InChI | InChI=1S/C19H22N2O3S.ClH/c1-12-4-7-14(20)10-16(12)19(23)21-17(11-18(22)24-2)13-5-8-15(25-3)9-6-13;/h4-10,17H,11,20H2,1-3H3,(H,21,23);1H |
| InChIKey | JXAJATUKPOWIJL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|