C16H25ClN2O3S — CID 119318307
methyl 3-(2-aminopentanoylamino)-3-(4-methylsulfanylphenyl)propanoate;hydrochloride (PubChem CID 119318307) has the molecular formula C16H25ClN2O3S and a molecular weight of 360.91 g/mol. Its IUPAC name is methyl 3-(2-aminopentanoylamino)-3-(4-methylsulfanylphenyl)propanoate;hydrochloride.
| Compound Name | methyl 3-(2-aminopentanoylamino)-3-(4-methylsulfanylphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119318307 |
| Molecular Formula | C16H25ClN2O3S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | methyl 3-(2-aminopentanoylamino)-3-(4-methylsulfanylphenyl)propanoate;hydrochloride |
| SMILES | CCCC(N)C(=O)NC(CC(=O)OC)c1ccc(SC)cc1.Cl |
| InChI | InChI=1S/C16H24N2O3S.ClH/c1-4-5-13(17)16(20)18-14(10-15(19)21-2)11-6-8-12(22-3)9-7-11;/h6-9,13-14H,4-5,10,17H2,1-3H3,(H,18,20);1H |
| InChIKey | ZXAQNQDJJKRLRF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |