C9H10ClN3O3S — CID 43356366
2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)-methylamino]acetic acid (PubChem CID 43356366) has the molecular formula C9H10ClN3O3S and a molecular weight of 275.72 g/mol. Its IUPAC name is 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)-methylamino]acetic acid.
| Compound Name | 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)-methylamino]acetic acid |
|---|---|
| PubChem CID | 43356366 |
| Molecular Formula | C9H10ClN3O3S |
| Molecular Weight | 275.72 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)-methylamino]acetic acid |
| SMILES | CSc1ncc(Cl)c(C(=O)N(C)CC(=O)O)n1 |
| InChI | InChI=1S/C9H10ClN3O3S/c1-13(4-6(14)15)8(16)7-5(10)3-11-9(12-7)17-2/h3H,4H2,1-2H3,(H,14,15) |
| InChIKey | BTGAFIRULAZEBH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.72 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |