C11H12ClN3O3S — CID 54945742
2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)-cyclopropylamino]acetic acid (PubChem CID 54945742) has the molecular formula C11H12ClN3O3S and a molecular weight of 301.75 g/mol. Its IUPAC name is 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)-cyclopropylamino]acetic acid.
| Compound Name | 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)-cyclopropylamino]acetic acid |
|---|---|
| PubChem CID | 54945742 |
| Molecular Formula | C11H12ClN3O3S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-[(5-chloro-2-methylsulfanylpyrimidine-4-carbonyl)-cyclopropylamino]acetic acid |
| SMILES | CSc1ncc(Cl)c(C(=O)N(CC(=O)O)C2CC2)n1 |
| InChI | InChI=1S/C11H12ClN3O3S/c1-19-11-13-4-7(12)9(14-11)10(18)15(5-8(16)17)6-2-3-6/h4,6H,2-3,5H2,1H3,(H,16,17) |
| InChIKey | CTSJFPTVELFUPN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |