C13H11ClIN3OS — CID 36860018
5-chloro-N-(3-iodo-4-methylphenyl)-2-methylsulfanylpyrimidine-4-carboxamide (PubChem CID 36860018) has the molecular formula C13H11ClIN3OS and a molecular weight of 419.68 g/mol. Its IUPAC name is 5-chloro-N-(3-iodo-4-methylphenyl)-2-methylsulfanylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(3-iodo-4-methylphenyl)-2-methylsulfanylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 36860018 |
| Molecular Formula | C13H11ClIN3OS |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 418.94 |
| IUPAC Name | 5-chloro-N-(3-iodo-4-methylphenyl)-2-methylsulfanylpyrimidine-4-carboxamide |
| SMILES | CSc1ncc(Cl)c(C(=O)Nc2ccc(C)c(I)c2)n1 |
| InChI | InChI=1S/C13H11ClIN3OS/c1-7-3-4-8(5-10(7)15)17-12(19)11-9(14)6-16-13(18-11)20-2/h3-6H,1-2H3,(H,17,19) |
| InChIKey | YQWYQKPLONBOPU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|