C12H10BrN3OS — CID 17014128
5-bromo-2-methylsulfanyl-N-phenylpyrimidine-4-carboxamide (PubChem CID 17014128) has the molecular formula C12H10BrN3OS and a molecular weight of 324.20 g/mol. Its IUPAC name is 5-bromo-2-methylsulfanyl-N-phenylpyrimidine-4-carboxamide.
| Compound Name | 5-bromo-2-methylsulfanyl-N-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 17014128 |
| Molecular Formula | C12H10BrN3OS |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | 5-bromo-2-methylsulfanyl-N-phenylpyrimidine-4-carboxamide |
| SMILES | CSc1ncc(Br)c(C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H10BrN3OS/c1-18-12-14-7-9(13)10(16-12)11(17)15-8-5-3-2-4-6-8/h2-7H,1H3,(H,15,17) |
| InChIKey | ACFRSSNVPKGAIM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |