C18H12BrF2N3OS — CID 35579565
5-bromo-N-(2-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]pyrimidine-4-carboxamide (PubChem CID 35579565) has the molecular formula C18H12BrF2N3OS and a molecular weight of 436.28 g/mol. Its IUPAC name is 5-bromo-N-(2-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]pyrimidine-4-carboxamide.
| Compound Name | 5-bromo-N-(2-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 35579565 |
| Molecular Formula | C18H12BrF2N3OS |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 5-bromo-N-(2-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1nc(SCc2ccccc2F)ncc1Br |
| InChI | InChI=1S/C18H12BrF2N3OS/c19-12-9-22-18(26-10-11-5-1-2-6-13(11)20)24-16(12)17(25)23-15-8-4-3-7-14(15)21/h1-9H,10H2,(H,23,25) |
| InChIKey | KUEYNZRQXICQEX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |