C19H13Cl2FN2O2S — CID 39867930
(4-chloro-3-methylphenyl) 5-chloro-2-[(2-fluorophenyl)methylsulfanyl]pyrimidine-4-carboxylate (PubChem CID 39867930) has the molecular formula C19H13Cl2FN2O2S and a molecular weight of 423.30 g/mol. Its IUPAC name is (4-chloro-3-methylphenyl) 5-chloro-2-[(2-fluorophenyl)methylsulfanyl]pyrimidine-4-carboxylate.
| Compound Name | (4-chloro-3-methylphenyl) 5-chloro-2-[(2-fluorophenyl)methylsulfanyl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 39867930 |
| Molecular Formula | C19H13Cl2FN2O2S |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | (4-chloro-3-methylphenyl) 5-chloro-2-[(2-fluorophenyl)methylsulfanyl]pyrimidine-4-carboxylate |
| SMILES | Cc1cc(OC(=O)c2nc(SCc3ccccc3F)ncc2Cl)ccc1Cl |
| InChI | InChI=1S/C19H13Cl2FN2O2S/c1-11-8-13(6-7-14(11)20)26-18(25)17-15(21)9-23-19(24-17)27-10-12-4-2-3-5-16(12)22/h2-9H,10H2,1H3 |
| InChIKey | PCWJUMKNOJTHRO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|