C19H14ClFN2O4S — CID 19119662
(4-fluorophenyl) 5-chloro-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxylate (PubChem CID 19119662) has the molecular formula C19H14ClFN2O4S and a molecular weight of 420.85 g/mol. Its IUPAC name is (4-fluorophenyl) 5-chloro-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxylate.
| Compound Name | (4-fluorophenyl) 5-chloro-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 19119662 |
| Molecular Formula | C19H14ClFN2O4S |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | (4-fluorophenyl) 5-chloro-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxylate |
| SMILES | Cc1ccccc1CS(=O)(=O)c1ncc(Cl)c(C(=O)Oc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H14ClFN2O4S/c1-12-4-2-3-5-13(12)11-28(25,26)19-22-10-16(20)17(23-19)18(24)27-15-8-6-14(21)7-9-15/h2-10H,11H2,1H3 |
| InChIKey | GHVANOZDGNXXHJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|