C13H11ClN2O4S — CID 39835107
phenyl 5-chloro-2-ethylsulfonylpyrimidine-4-carboxylate (PubChem CID 39835107) has the molecular formula C13H11ClN2O4S and a molecular weight of 326.76 g/mol. Its IUPAC name is phenyl 5-chloro-2-ethylsulfonylpyrimidine-4-carboxylate.
| Compound Name | phenyl 5-chloro-2-ethylsulfonylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 39835107 |
| Molecular Formula | C13H11ClN2O4S |
| Molecular Weight | 326.76 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | phenyl 5-chloro-2-ethylsulfonylpyrimidine-4-carboxylate |
| SMILES | CCS(=O)(=O)c1ncc(Cl)c(C(=O)Oc2ccccc2)n1 |
| InChI | InChI=1S/C13H11ClN2O4S/c1-2-21(18,19)13-15-8-10(14)11(16-13)12(17)20-9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | QFQJEHRSXOKEPV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|