C14H13ClN2O4S — CID 39835011
phenyl 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate (PubChem CID 39835011) has the molecular formula C14H13ClN2O4S and a molecular weight of 340.79 g/mol. Its IUPAC name is phenyl 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate.
| Compound Name | phenyl 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 39835011 |
| Molecular Formula | C14H13ClN2O4S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | phenyl 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate |
| SMILES | CCCS(=O)(=O)c1ncc(Cl)c(C(=O)Oc2ccccc2)n1 |
| InChI | InChI=1S/C14H13ClN2O4S/c1-2-8-22(19,20)14-16-9-11(15)12(17-14)13(18)21-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3 |
| InChIKey | QGZQRFZFMMEEHF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|