C14H12ClIN2O4S — CID 18880005
(4-iodophenyl) 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate (PubChem CID 18880005) has the molecular formula C14H12ClIN2O4S and a molecular weight of 466.68 g/mol. Its IUPAC name is (4-iodophenyl) 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate.
| Compound Name | (4-iodophenyl) 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 18880005 |
| Molecular Formula | C14H12ClIN2O4S |
| Molecular Weight | 466.68 g/mol |
| Exact Mass | 465.93 |
| IUPAC Name | (4-iodophenyl) 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate |
| SMILES | CCCS(=O)(=O)c1ncc(Cl)c(C(=O)Oc2ccc(I)cc2)n1 |
| InChI | InChI=1S/C14H12ClIN2O4S/c1-2-7-23(20,21)14-17-8-11(15)12(18-14)13(19)22-10-5-3-9(16)4-6-10/h3-6,8H,2,7H2,1H3 |
| InChIKey | WQIBCSOBYGNGIU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|