C14H12Cl3N3O3S — CID 18879986
5-chloro-N-(2,3-dichlorophenyl)-2-propylsulfonylpyrimidine-4-carboxamide (PubChem CID 18879986) has the molecular formula C14H12Cl3N3O3S and a molecular weight of 408.69 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dichlorophenyl)-2-propylsulfonylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(2,3-dichlorophenyl)-2-propylsulfonylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 18879986 |
| Molecular Formula | C14H12Cl3N3O3S |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | 5-chloro-N-(2,3-dichlorophenyl)-2-propylsulfonylpyrimidine-4-carboxamide |
| SMILES | CCCS(=O)(=O)c1ncc(Cl)c(C(=O)Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C14H12Cl3N3O3S/c1-2-6-24(22,23)14-18-7-9(16)12(20-14)13(21)19-10-5-3-4-8(15)11(10)17/h3-5,7H,2,6H2,1H3,(H,19,21) |
| InChIKey | WTLVWVQHMKAWAZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |