C12H9Cl2N3O3S — CID 2985513
5-chloro-N-(2-chlorophenyl)-2-methylsulfonylpyrimidine-4-carboxamide (PubChem CID 2985513) has the molecular formula C12H9Cl2N3O3S and a molecular weight of 346.20 g/mol. Its IUPAC name is 5-chloro-N-(2-chlorophenyl)-2-methylsulfonylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(2-chlorophenyl)-2-methylsulfonylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 2985513 |
| Molecular Formula | C12H9Cl2N3O3S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 5-chloro-N-(2-chlorophenyl)-2-methylsulfonylpyrimidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ncc(Cl)c(C(=O)Nc2ccccc2Cl)n1 |
| InChI | InChI=1S/C12H9Cl2N3O3S/c1-21(19,20)12-15-6-8(14)10(17-12)11(18)16-9-5-3-2-4-7(9)13/h2-6H,1H3,(H,16,18) |
| InChIKey | MUTHFCZOXUWWCQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |