C13H13ClN4O3S — CID 19245791
5-chloro-2-ethylsulfonyl-N-(6-methyl-2-pyridinyl)pyrimidine-4-carboxamide (PubChem CID 19245791) has the molecular formula C13H13ClN4O3S and a molecular weight of 340.79 g/mol. Its IUPAC name is 5-chloro-2-ethylsulfonyl-N-(6-methyl-2-pyridinyl)pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-2-ethylsulfonyl-N-(6-methyl-2-pyridinyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 19245791 |
| Molecular Formula | C13H13ClN4O3S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 5-chloro-2-ethylsulfonyl-N-(6-methyl-2-pyridinyl)pyrimidine-4-carboxamide |
| SMILES | CCS(=O)(=O)c1ncc(Cl)c(C(=O)Nc2cccc(C)n2)n1 |
| InChI | InChI=1S/C13H13ClN4O3S/c1-3-22(20,21)13-15-7-9(14)11(18-13)12(19)17-10-6-4-5-8(2)16-10/h4-7H,3H2,1-2H3,(H,16,17,19) |
| InChIKey | IQEPNQAVLPZOLC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |