C14H14ClN3O4S — CID 2988172
5-chloro-2-ethylsulfonyl-N-(4-methoxyphenyl)pyrimidine-4-carboxamide (PubChem CID 2988172) has the molecular formula C14H14ClN3O4S and a molecular weight of 355.80 g/mol. Its IUPAC name is 5-chloro-2-ethylsulfonyl-N-(4-methoxyphenyl)pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-2-ethylsulfonyl-N-(4-methoxyphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 2988172 |
| Molecular Formula | C14H14ClN3O4S |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 5-chloro-2-ethylsulfonyl-N-(4-methoxyphenyl)pyrimidine-4-carboxamide |
| SMILES | CCS(=O)(=O)c1ncc(Cl)c(C(=O)Nc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C14H14ClN3O4S/c1-3-23(20,21)14-16-8-11(15)12(18-14)13(19)17-9-4-6-10(22-2)7-5-9/h4-8H,3H2,1-2H3,(H,17,19) |
| InChIKey | PHBKVCRXIZOBIO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |