C19H15BrClN3O3S — CID 19119637
N-(4-bromophenyl)-5-chloro-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide (PubChem CID 19119637) has the molecular formula C19H15BrClN3O3S and a molecular weight of 480.77 g/mol. Its IUPAC name is N-(4-bromophenyl)-5-chloro-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide.
| Compound Name | N-(4-bromophenyl)-5-chloro-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 19119637 |
| Molecular Formula | C19H15BrClN3O3S |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | N-(4-bromophenyl)-5-chloro-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide |
| SMILES | Cc1ccccc1CS(=O)(=O)c1ncc(Cl)c(C(=O)Nc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C19H15BrClN3O3S/c1-12-4-2-3-5-13(12)11-28(26,27)19-22-10-16(21)17(24-19)18(25)23-15-8-6-14(20)7-9-15/h2-10H,11H2,1H3,(H,23,25) |
| InChIKey | OLCUYDOKUWHXTL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |