C17H16ClN5O3S3 — CID 19119772
5-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide (PubChem CID 19119772) has the molecular formula C17H16ClN5O3S3 and a molecular weight of 470.00 g/mol. Its IUPAC name is 5-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 19119772 |
| Molecular Formula | C17H16ClN5O3S3 |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | 5-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2nc(S(=O)(=O)Cc3ccccc3C)ncc2Cl)s1 |
| InChI | InChI=1S/C17H16ClN5O3S3/c1-3-27-17-23-22-15(28-17)21-14(24)13-12(18)8-19-16(20-13)29(25,26)9-11-7-5-4-6-10(11)2/h4-8H,3,9H2,1-2H3,(H,21,22,24) |
| InChIKey | DFGQQNAKNOQOCZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|