C15H14N4OS3 — CID 43854818
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-methyl-5-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 43854818) has the molecular formula C15H14N4OS3 and a molecular weight of 362.51 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-methyl-5-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-methyl-5-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 43854818 |
| Molecular Formula | C15H14N4OS3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-methyl-5-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2nc(C)sc2-c2ccccc2)s1 |
| InChI | InChI=1S/C15H14N4OS3/c1-3-21-15-19-18-14(23-15)17-13(20)11-12(22-9(2)16-11)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3,(H,17,18,20) |
| InChIKey | YYXAVEVFPXJDQA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|