C16H15ClN6OS2 — CID 53384944
2-(benzylamino)-5-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)pyrimidine-4-carboxamide (PubChem CID 53384944) has the molecular formula C16H15ClN6OS2 and a molecular weight of 406.92 g/mol. Its IUPAC name is 2-(benzylamino)-5-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)pyrimidine-4-carboxamide.
| Compound Name | 2-(benzylamino)-5-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 53384944 |
| Molecular Formula | C16H15ClN6OS2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-(benzylamino)-5-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)pyrimidine-4-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2nc(NCc3ccccc3)ncc2Cl)s1 |
| InChI | InChI=1S/C16H15ClN6OS2/c1-2-25-16-23-22-15(26-16)21-13(24)12-11(17)9-19-14(20-12)18-8-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,18,19,20)(H,21,22,24) |
| InChIKey | FULGKQQGQOAYSO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|