C18H18ClN5O3S3 — CID 19119742
5-chloro-2-[(2-methylphenyl)methylsulfonyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrimidine-4-carboxamide (PubChem CID 19119742) has the molecular formula C18H18ClN5O3S3 and a molecular weight of 484.03 g/mol. Its IUPAC name is 5-chloro-2-[(2-methylphenyl)methylsulfonyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-2-[(2-methylphenyl)methylsulfonyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 19119742 |
| Molecular Formula | C18H18ClN5O3S3 |
| Molecular Weight | 484.03 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 5-chloro-2-[(2-methylphenyl)methylsulfonyl]-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrimidine-4-carboxamide |
| SMILES | CCCSc1nnc(NC(=O)c2nc(S(=O)(=O)Cc3ccccc3C)ncc2Cl)s1 |
| InChI | InChI=1S/C18H18ClN5O3S3/c1-3-8-28-18-24-23-16(29-18)22-15(25)14-13(19)9-20-17(21-14)30(26,27)10-12-7-5-4-6-11(12)2/h4-7,9H,3,8,10H2,1-2H3,(H,22,23,25) |
| InChIKey | CYTMQQXCZROFLL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.03 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|