C14H17N3OS3 — CID 100504993
(2R)-2-benzylsulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 100504993) has the molecular formula C14H17N3OS3 and a molecular weight of 339.51 g/mol. Its IUPAC name is (2R)-2-benzylsulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2R)-2-benzylsulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 100504993 |
| Molecular Formula | C14H17N3OS3 |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (2R)-2-benzylsulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCSc1nnc(NC(=O)[C@@H](C)SCc2ccccc2)s1 |
| InChI | InChI=1S/C14H17N3OS3/c1-3-19-14-17-16-13(21-14)15-12(18)10(2)20-9-11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3,(H,15,16,18)/t10-/m1/s1 |
| InChIKey | DPMPEYMHORGBSY-SNVBAGLBSA-N |
| XLogP | 3.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|