C20H20N4O3S2 — CID 19098297
benzyl N-[1-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 19098297) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is benzyl N-[1-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 19098297 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | benzyl N-[1-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)Nc1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C20H20N4O3S2/c1-14(21-19(26)27-12-15-8-4-2-5-9-15)17(25)22-18-23-24-20(29-18)28-13-16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3,(H,21,26)(H,22,23,25) |
| InChIKey | DTCBUQWACJOAPZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|