C20H17N5OS2 — CID 2121252
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 2121252) has the molecular formula C20H17N5OS2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2121252 |
| Molecular Formula | C20H17N5OS2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)s1 |
| InChI | InChI=1S/C20H17N5OS2/c1-2-27-20-23-22-19(28-20)21-18(26)16-13-25(15-11-7-4-8-12-15)24-17(16)14-9-5-3-6-10-14/h3-13H,2H2,1H3,(H,21,22,26) |
| InChIKey | NYZQQBAGQGYWCF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|