C16H13ClN4O3S — CID 19245702
5-chloro-N-(2-methylquinolin-5-yl)-2-methylsulfonylpyrimidine-4-carboxamide (PubChem CID 19245702) has the molecular formula C16H13ClN4O3S and a molecular weight of 376.83 g/mol. Its IUPAC name is 5-chloro-N-(2-methylquinolin-5-yl)-2-methylsulfonylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(2-methylquinolin-5-yl)-2-methylsulfonylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 19245702 |
| Molecular Formula | C16H13ClN4O3S |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 5-chloro-N-(2-methylquinolin-5-yl)-2-methylsulfonylpyrimidine-4-carboxamide |
| SMILES | Cc1ccc2c(NC(=O)c3nc(S(C)(=O)=O)ncc3Cl)cccc2n1 |
| InChI | InChI=1S/C16H13ClN4O3S/c1-9-6-7-10-12(19-9)4-3-5-13(10)20-15(22)14-11(17)8-18-16(21-14)25(2,23)24/h3-8H,1-2H3,(H,20,22) |
| InChIKey | DRRHQEPOBXQFSA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |