C19H14Cl2N2O4S — CID 39867214
(4-chlorophenyl) 5-chloro-2-[(4-methylphenyl)methylsulfonyl]pyrimidine-4-carboxylate (PubChem CID 39867214) has the molecular formula C19H14Cl2N2O4S and a molecular weight of 437.30 g/mol. Its IUPAC name is (4-chlorophenyl) 5-chloro-2-[(4-methylphenyl)methylsulfonyl]pyrimidine-4-carboxylate.
| Compound Name | (4-chlorophenyl) 5-chloro-2-[(4-methylphenyl)methylsulfonyl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 39867214 |
| Molecular Formula | C19H14Cl2N2O4S |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | (4-chlorophenyl) 5-chloro-2-[(4-methylphenyl)methylsulfonyl]pyrimidine-4-carboxylate |
| SMILES | Cc1ccc(CS(=O)(=O)c2ncc(Cl)c(C(=O)Oc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C19H14Cl2N2O4S/c1-12-2-4-13(5-3-12)11-28(25,26)19-22-10-16(21)17(23-19)18(24)27-15-8-6-14(20)7-9-15/h2-10H,11H2,1H3 |
| InChIKey | TWQZDQGTSSPMFJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|