C21H16Cl2N2O5S — CID 39867251
(4-acetyl-2-methylphenyl) 5-chloro-2-[(4-chlorophenyl)methylsulfonyl]pyrimidine-4-carboxylate (PubChem CID 39867251) has the molecular formula C21H16Cl2N2O5S and a molecular weight of 479.34 g/mol. Its IUPAC name is (4-acetyl-2-methylphenyl) 5-chloro-2-[(4-chlorophenyl)methylsulfonyl]pyrimidine-4-carboxylate.
| Compound Name | (4-acetyl-2-methylphenyl) 5-chloro-2-[(4-chlorophenyl)methylsulfonyl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 39867251 |
| Molecular Formula | C21H16Cl2N2O5S |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | (4-acetyl-2-methylphenyl) 5-chloro-2-[(4-chlorophenyl)methylsulfonyl]pyrimidine-4-carboxylate |
| SMILES | CC(=O)c1ccc(OC(=O)c2nc(S(=O)(=O)Cc3ccc(Cl)cc3)ncc2Cl)c(C)c1 |
| InChI | InChI=1S/C21H16Cl2N2O5S/c1-12-9-15(13(2)26)5-8-18(12)30-20(27)19-17(23)10-24-21(25-19)31(28,29)11-14-3-6-16(22)7-4-14/h3-10H,11H2,1-2H3 |
| InChIKey | BFBCLIFSDWJQQP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|