C15H12ClN3O4S — CID 18880006
(4-cyanophenyl) 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate (PubChem CID 18880006) has the molecular formula C15H12ClN3O4S and a molecular weight of 365.80 g/mol. Its IUPAC name is (4-cyanophenyl) 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate.
| Compound Name | (4-cyanophenyl) 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 18880006 |
| Molecular Formula | C15H12ClN3O4S |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | (4-cyanophenyl) 5-chloro-2-propylsulfonylpyrimidine-4-carboxylate |
| SMILES | CCCS(=O)(=O)c1ncc(Cl)c(C(=O)Oc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C15H12ClN3O4S/c1-2-7-24(21,22)15-18-9-12(16)13(19-15)14(20)23-11-5-3-10(8-17)4-6-11/h3-6,9H,2,7H2,1H3 |
| InChIKey | UEXSVQBGLOFMCR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 110.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|