C21H19ClN4O4S — CID 19119440
5-chloro-N-(4-ethoxy-2-nitrophenyl)-2-[(2-methylphenyl)methylsulfanyl]pyrimidine-4-carboxamide (PubChem CID 19119440) has the molecular formula C21H19ClN4O4S and a molecular weight of 458.93 g/mol. Its IUPAC name is 5-chloro-N-(4-ethoxy-2-nitrophenyl)-2-[(2-methylphenyl)methylsulfanyl]pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(4-ethoxy-2-nitrophenyl)-2-[(2-methylphenyl)methylsulfanyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 19119440 |
| Molecular Formula | C21H19ClN4O4S |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 5-chloro-N-(4-ethoxy-2-nitrophenyl)-2-[(2-methylphenyl)methylsulfanyl]pyrimidine-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2nc(SCc3ccccc3C)ncc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19ClN4O4S/c1-3-30-15-8-9-17(18(10-15)26(28)29)24-20(27)19-16(22)11-23-21(25-19)31-12-14-7-5-4-6-13(14)2/h4-11H,3,12H2,1-2H3,(H,24,27) |
| InChIKey | VOOOMNTVMWICEX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|