C18H14Cl2N4O4 — CID 19513589
3-(3,4-dichlorophenyl)-N-(4-ethoxy-2-nitrophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19513589) has the molecular formula C18H14Cl2N4O4 and a molecular weight of 421.24 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-(4-ethoxy-2-nitrophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-(4-ethoxy-2-nitrophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19513589 |
| Molecular Formula | C18H14Cl2N4O4 |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-(4-ethoxy-2-nitrophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(-c3ccc(Cl)c(Cl)c3)n[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14Cl2N4O4/c1-2-28-11-4-6-14(17(8-11)24(26)27)21-18(25)16-9-15(22-23-16)10-3-5-12(19)13(20)7-10/h3-9H,2H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | YORONAXUCIVQHP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|