C16H19BrN4 — CID 112910303
N-(3-bromophenyl)-6-methyl-2-piperidin-1-ylpyrimidin-4-amine (PubChem CID 112910303) has the molecular formula C16H19BrN4 and a molecular weight of 347.26 g/mol. Its IUPAC name is N-(3-bromophenyl)-6-methyl-2-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-(3-bromophenyl)-6-methyl-2-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112910303 |
| Molecular Formula | C16H19BrN4 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-(3-bromophenyl)-6-methyl-2-piperidin-1-ylpyrimidin-4-amine |
| SMILES | Cc1cc(Nc2cccc(Br)c2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C16H19BrN4/c1-12-10-15(19-14-7-5-6-13(17)11-14)20-16(18-12)21-8-3-2-4-9-21/h5-7,10-11H,2-4,8-9H2,1H3,(H,18,19,20) |
| InChIKey | KHUCFEPUZNSMGO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |