C24H26N4O4 — CID 70033512
1-[4-[(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)amino]phenyl]-1-(2-methoxyethyl)urea (PubChem CID 70033512) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-[4-[(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)amino]phenyl]-1-(2-methoxyethyl)urea.
| Compound Name | 1-[4-[(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)amino]phenyl]-1-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 70033512 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[4-[(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)amino]phenyl]-1-(2-methoxyethyl)urea |
| SMILES | COCCN(C(N)=O)c1ccc(NC2=C(N3CCCC3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H26N4O4/c1-32-15-14-28(24(25)31)17-10-8-16(9-11-17)26-20-21(27-12-4-5-13-27)23(30)19-7-3-2-6-18(19)22(20)29/h2-3,6-11,26H,4-5,12-15H2,1H3,(H2,25,31) |
| InChIKey | NPXKFMZBVUWCRM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|