C30H21F5N2O3 — CID 5380098
2-[4-[(E)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]anilino]-3-piperidin-1-ylnaphthalene-1,4-dione (PubChem CID 5380098) has the molecular formula C30H21F5N2O3 and a molecular weight of 552.50 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]anilino]-3-piperidin-1-ylnaphthalene-1,4-dione.
| Compound Name | 2-[4-[(E)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]anilino]-3-piperidin-1-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 5380098 |
| Molecular Formula | C30H21F5N2O3 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 2-[4-[(E)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]anilino]-3-piperidin-1-ylnaphthalene-1,4-dione |
| SMILES | O=C(/C=C/c1c(F)c(F)c(F)c(F)c1F)c1ccc(NC2=C(N3CCCCC3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C30H21F5N2O3/c31-22-20(23(32)25(34)26(35)24(22)33)12-13-21(38)16-8-10-17(11-9-16)36-27-28(37-14-4-1-5-15-37)30(40)19-7-3-2-6-18(19)29(27)39/h2-3,6-13,36H,1,4-5,14-15H2/b13-12+ |
| InChIKey | ZNIOPDPOTNTKHE-OUKQBFOZSA-N |
| XLogP | 6.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|