C20H20FNO — CID 19560783
(E)-3-(2-fluorophenyl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one (PubChem CID 19560783) has the molecular formula C20H20FNO and a molecular weight of 309.38 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-fluorophenyl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19560783 |
| Molecular Formula | C20H20FNO |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1F)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H20FNO/c21-19-7-3-2-6-16(19)10-13-20(23)17-8-11-18(12-9-17)22-14-4-1-5-15-22/h2-3,6-13H,1,4-5,14-15H2/b13-10+ |
| InChIKey | JOWOPACGTHTYSS-JLHYYAGUSA-N |
| XLogP | 4.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|