C24H23N3O — CID 55838600
(E)-3-(2-phenylpyrimidin-5-yl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one (PubChem CID 55838600) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is (E)-3-(2-phenylpyrimidin-5-yl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-phenylpyrimidin-5-yl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55838600 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (E)-3-(2-phenylpyrimidin-5-yl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cnc(-c2ccccc2)nc1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H23N3O/c28-23(20-10-12-22(13-11-20)27-15-5-2-6-16-27)14-9-19-17-25-24(26-18-19)21-7-3-1-4-8-21/h1,3-4,7-14,17-18H,2,5-6,15-16H2/b14-9+ |
| InChIKey | OWYVBYQNGQDLAD-NTEUORMPSA-N |
| XLogP | 5.03 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|