C25H25NOS — CID 19560916
(E)-3-(5-benzylthiophen-2-yl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one (PubChem CID 19560916) has the molecular formula C25H25NOS and a molecular weight of 387.55 g/mol. Its IUPAC name is (E)-3-(5-benzylthiophen-2-yl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(5-benzylthiophen-2-yl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19560916 |
| Molecular Formula | C25H25NOS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (E)-3-(5-benzylthiophen-2-yl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cc2ccccc2)s1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H25NOS/c27-25(21-9-11-22(12-10-21)26-17-5-2-6-18-26)16-15-23-13-14-24(28-23)19-20-7-3-1-4-8-20/h1,3-4,7-16H,2,5-6,17-19H2/b16-15+ |
| InChIKey | OGCRWAGITVRKTM-FOCLMDBBSA-N |
| XLogP | 6.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|