C22H22ClNO — CID 19560944
(2E,4Z)-4-chloro-5-phenyl-1-(4-piperidin-1-ylphenyl)penta-2,4-dien-1-one (PubChem CID 19560944) has the molecular formula C22H22ClNO and a molecular weight of 351.88 g/mol. Its IUPAC name is (2E,4Z)-4-chloro-5-phenyl-1-(4-piperidin-1-ylphenyl)penta-2,4-dien-1-one.
| Compound Name | (2E,4Z)-4-chloro-5-phenyl-1-(4-piperidin-1-ylphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 19560944 |
| Molecular Formula | C22H22ClNO |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (2E,4Z)-4-chloro-5-phenyl-1-(4-piperidin-1-ylphenyl)penta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C(Cl)=C/c1ccccc1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H22ClNO/c23-20(17-18-7-3-1-4-8-18)11-14-22(25)19-9-12-21(13-10-19)24-15-5-2-6-16-24/h1,3-4,7-14,17H,2,5-6,15-16H2/b14-11+,20-17- |
| InChIKey | LCPAMCXOVQXFQK-DBAYFNDFSA-N |
| XLogP | 5.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|