C30H28N2OS — CID 175257552
(E)-1-[4-(N-phenylanilino)phenyl]-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-en-1-one (PubChem CID 175257552) has the molecular formula C30H28N2OS and a molecular weight of 464.63 g/mol. Its IUPAC name is (E)-1-[4-(N-phenylanilino)phenyl]-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(N-phenylanilino)phenyl]-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175257552 |
| Molecular Formula | C30H28N2OS |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (E)-1-[4-(N-phenylanilino)phenyl]-3-(5-piperidin-1-ylthiophen-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(N2CCCCC2)s1)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2OS/c33-29(20-18-28-19-21-30(34-28)31-22-8-3-9-23-31)24-14-16-27(17-15-24)32(25-10-4-1-5-11-25)26-12-6-2-7-13-26/h1-2,4-7,10-21H,3,8-9,22-23H2/b20-18+ |
| InChIKey | RGMJMEAETJCLBS-CZIZESTLSA-N |
| XLogP | 8.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|